About ethane;2-fluorobenzoic acid
ethane;2-fluorobenzoic acid (PubChem CID 91182768) has the molecular formula C9H11FO2
and a molecular weight of 170.18 g/mol. Its IUPAC name is ethane;2-fluorobenzoic acid.
Molecular Properties
| Compound Name | ethane;2-fluorobenzoic acid |
| PubChem CID | 91182768 |
| Molecular Formula | C9H11FO2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | ethane;2-fluorobenzoic acid |
| SMILES | CC.O=C(O)c1ccccc1F |
| InChI | InChI=1S/C7H5FO2.C2H6/c8-6-4-2-1-3-5(6)7(9)10;1-2/h1-4H,(H,9,10);1-2H3 |
| InChIKey | GJLJSFYNOPLAOG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluorobenzoic acid?
The IUPAC name of ethane;2-fluorobenzoic acid (CID 91182768) is ethane;2-fluorobenzoic acid.
What is the SMILES notation for ethane;2-fluorobenzoic acid?
The canonical SMILES for ethane;2-fluorobenzoic acid is CC.O=C(O)c1ccccc1F.
What is the InChIKey of ethane;2-fluorobenzoic acid?
The InChIKey is GJLJSFYNOPLAOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FO2.C2H6/c8-6-4-2-1-3-5(6)7(9)10;1-2/h1-4H,(H,9,10);1-2H3.
What are the key properties of ethane;2-fluorobenzoic acid?
ethane;2-fluorobenzoic acid has a molecular weight of 170.18 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluorobenzoic acid is sourced from PubChem (CID 91182768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).