About 2-fluorobenzoic acid;oxalic acid;hydrate
2-fluorobenzoic acid;oxalic acid;hydrate (PubChem CID 172785033) has the molecular formula C9H9FO7
and a molecular weight of 248.16 g/mol. Its IUPAC name is 2-fluorobenzoic acid;oxalic acid;hydrate.
Molecular Properties
| Compound Name | 2-fluorobenzoic acid;oxalic acid;hydrate |
| PubChem CID | 172785033 |
| Molecular Formula | C9H9FO7 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-fluorobenzoic acid;oxalic acid;hydrate |
| SMILES | O.O=C(O)C(=O)O.O=C(O)c1ccccc1F |
| InChI | InChI=1S/C7H5FO2.C2H2O4.H2O/c8-6-4-2-1-3-5(6)7(9)10;3-1(4)2(5)6;/h1-4H,(H,9,10);(H,3,4)(H,5,6);1H2 |
| InChIKey | OTWIPNWESREQPR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorobenzoic acid;oxalic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobenzoic acid;oxalic acid;hydrate?
The IUPAC name of 2-fluorobenzoic acid;oxalic acid;hydrate (CID 172785033) is 2-fluorobenzoic acid;oxalic acid;hydrate.
What is the SMILES notation for 2-fluorobenzoic acid;oxalic acid;hydrate?
The canonical SMILES for 2-fluorobenzoic acid;oxalic acid;hydrate is O.O=C(O)C(=O)O.O=C(O)c1ccccc1F.
What is the InChIKey of 2-fluorobenzoic acid;oxalic acid;hydrate?
The InChIKey is OTWIPNWESREQPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FO2.C2H2O4.H2O/c8-6-4-2-1-3-5(6)7(9)10;3-1(4)2(5)6;/h1-4H,(H,9,10);(H,3,4)(H,5,6);1H2.
What are the key properties of 2-fluorobenzoic acid;oxalic acid;hydrate?
2-fluorobenzoic acid;oxalic acid;hydrate has a molecular weight of 248.16 g/mol, XLogP of -0.15, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobenzoic acid;oxalic acid;hydrate is sourced from PubChem (CID 172785033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).