About 2-fluorobenzoyl chloride
2-fluorobenzoyl chloride (PubChem CID 9808) has the molecular formula C7H4ClFO
and a molecular weight of 158.56 g/mol. Its IUPAC name is 2-fluorobenzoyl chloride.
Molecular Properties
| Compound Name | 2-fluorobenzoyl chloride |
| PubChem CID | 9808 |
| Molecular Formula | C7H4ClFO |
| Molecular Weight | 158.56 g/mol |
| Exact Mass | 157.99 |
| IUPAC Name | 2-fluorobenzoyl chloride |
| SMILES | O=C(Cl)c1ccccc1F |
| InChI | InChI=1S/C7H4ClFO/c8-7(10)5-3-1-2-4-6(5)9/h1-4H |
| InChIKey | RAAGZOYMEQDCTD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.56 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobenzoyl chloride?
The IUPAC name of 2-fluorobenzoyl chloride (CID 9808) is 2-fluorobenzoyl chloride.
What is the SMILES notation for 2-fluorobenzoyl chloride?
The canonical SMILES for 2-fluorobenzoyl chloride is O=C(Cl)c1ccccc1F.
What is the InChIKey of 2-fluorobenzoyl chloride?
The InChIKey is RAAGZOYMEQDCTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClFO/c8-7(10)5-3-1-2-4-6(5)9/h1-4H.
What are the key properties of 2-fluorobenzoyl chloride?
2-fluorobenzoyl chloride has a molecular weight of 158.56 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobenzoyl chloride is sourced from PubChem (CID 9808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).