C13H7Cl2FO — CID 13127035
(2,6-dichlorophenyl)-(2-fluorophenyl)methanone (PubChem CID 13127035) has the molecular formula C13H7Cl2FO and a molecular weight of 269.10 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-(2-fluorophenyl)methanone.
| Compound Name | (2,6-dichlorophenyl)-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 13127035 |
| Molecular Formula | C13H7Cl2FO |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | (2,6-dichlorophenyl)-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H7Cl2FO/c14-9-5-3-6-10(15)12(9)13(17)8-4-1-2-7-11(8)16/h1-7H |
| InChIKey | ZXBFOJHBBGEREU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |