C14H8Cl2F2O — CID 114275342
(6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone (PubChem CID 114275342) has the molecular formula C14H8Cl2F2O and a molecular weight of 301.12 g/mol. Its IUPAC name is (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone.
| Compound Name | (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 114275342 |
| Molecular Formula | C14H8Cl2F2O |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone |
| SMILES | Cc1c(Cl)cccc1C(=O)c1c(Cl)ccc(F)c1F |
| InChI | InChI=1S/C14H8Cl2F2O/c1-7-8(3-2-4-9(7)15)14(19)12-10(16)5-6-11(17)13(12)18/h2-6H,1H3 |
| InChIKey | HPOFYVIJIPRYTN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|