About (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone
(6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone (PubChem CID 114275342) has the molecular formula C14H8Cl2F2O
and a molecular weight of 301.12 g/mol. Its IUPAC name is (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone.
Molecular Properties
| Compound Name | (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone |
| PubChem CID | 114275342 |
| Molecular Formula | C14H8Cl2F2O |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone |
| SMILES | Cc1c(Cl)cccc1C(=O)c1c(Cl)ccc(F)c1F |
| InChI | InChI=1S/C14H8Cl2F2O/c1-7-8(3-2-4-9(7)15)14(19)12-10(16)5-6-11(17)13(12)18/h2-6H,1H3 |
| InChIKey | HPOFYVIJIPRYTN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone?
The IUPAC name of (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone (CID 114275342) is (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone.
What is the SMILES notation for (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone?
The canonical SMILES for (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone is Cc1c(Cl)cccc1C(=O)c1c(Cl)ccc(F)c1F.
What is the InChIKey of (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone?
The InChIKey is HPOFYVIJIPRYTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2F2O/c1-7-8(3-2-4-9(7)15)14(19)12-10(16)5-6-11(17)13(12)18/h2-6H,1H3.
What are the key properties of (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone?
(6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone has a molecular weight of 301.12 g/mol, XLogP of 4.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-2,3-difluorophenyl)-(3-chloro-2-methylphenyl)methanone is sourced from PubChem (CID 114275342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).