C8H3ClF4O — CID 130512059
1-(6-chloro-2,3-difluorophenyl)-2,2-difluoroethanone (PubChem CID 130512059) has the molecular formula C8H3ClF4O and a molecular weight of 226.56 g/mol. Its IUPAC name is 1-(6-chloro-2,3-difluorophenyl)-2,2-difluoroethanone.
| Compound Name | 1-(6-chloro-2,3-difluorophenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 130512059 |
| Molecular Formula | C8H3ClF4O |
| Molecular Weight | 226.56 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | 1-(6-chloro-2,3-difluorophenyl)-2,2-difluoroethanone |
| SMILES | O=C(c1c(Cl)ccc(F)c1F)C(F)F |
| InChI | InChI=1S/C8H3ClF4O/c9-3-1-2-4(10)6(11)5(3)7(14)8(12)13/h1-2,8H |
| InChIKey | ZXARGCSLFHFNLO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|