C9H6F4O2 — CID 134648361
methyl 6-(difluoromethyl)-2,3-difluorobenzoate (PubChem CID 134648361) has the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. Its IUPAC name is methyl 6-(difluoromethyl)-2,3-difluorobenzoate.
| Compound Name | methyl 6-(difluoromethyl)-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 134648361 |
| Molecular Formula | C9H6F4O2 |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | methyl 6-(difluoromethyl)-2,3-difluorobenzoate |
| SMILES | COC(=O)c1c(C(F)F)ccc(F)c1F |
| InChI | InChI=1S/C9H6F4O2/c1-15-9(14)6-4(8(12)13)2-3-5(10)7(6)11/h2-3,8H,1H3 |
| InChIKey | YEKFXYWQPYQBFU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |