C8H5Br2F2NO2 — CID 134676395
methyl 2,6-dibromo-4-(difluoromethyl)pyridine-3-carboxylate (PubChem CID 134676395) has the molecular formula C8H5Br2F2NO2 and a molecular weight of 344.94 g/mol. Its IUPAC name is methyl 2,6-dibromo-4-(difluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 2,6-dibromo-4-(difluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134676395 |
| Molecular Formula | C8H5Br2F2NO2 |
| Molecular Weight | 344.94 g/mol |
| Exact Mass | 342.87 |
| IUPAC Name | methyl 2,6-dibromo-4-(difluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)F)cc(Br)nc1Br |
| InChI | InChI=1S/C8H5Br2F2NO2/c1-15-8(14)5-3(7(11)12)2-4(9)13-6(5)10/h2,7H,1H3 |
| InChIKey | RICNFAUNGGCVKK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.94 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|