C7H6BrF2N3O — CID 118999240
2-amino-6-bromo-4-(difluoromethyl)pyridine-3-carboxamide (PubChem CID 118999240) has the molecular formula C7H6BrF2N3O and a molecular weight of 266.05 g/mol. Its IUPAC name is 2-amino-6-bromo-4-(difluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-amino-6-bromo-4-(difluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118999240 |
| Molecular Formula | C7H6BrF2N3O |
| Molecular Weight | 266.05 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 2-amino-6-bromo-4-(difluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(C(F)F)cc(Br)nc1N |
| InChI | InChI=1S/C7H6BrF2N3O/c8-3-1-2(5(9)10)4(7(12)14)6(11)13-3/h1,5H,(H2,11,13)(H2,12,14) |
| InChIKey | RPTUFOSTWUJKFH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.05 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|