C7H7F2N3O — CID 119001621
6-amino-5-(difluoromethyl)pyridine-2-carboxamide (PubChem CID 119001621) has the molecular formula C7H7F2N3O and a molecular weight of 187.15 g/mol. Its IUPAC name is 6-amino-5-(difluoromethyl)pyridine-2-carboxamide.
| Compound Name | 6-amino-5-(difluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 119001621 |
| Molecular Formula | C7H7F2N3O |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 6-amino-5-(difluoromethyl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(C(F)F)c(N)n1 |
| InChI | InChI=1S/C7H7F2N3O/c8-5(9)3-1-2-4(7(11)13)12-6(3)10/h1-2,5H,(H2,10,12)(H2,11,13) |
| InChIKey | SPIGIPGSZHHCBL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |