C8H7F3N2O — CID 118851932
4-(difluoromethyl)-5-fluoro-6-methylpyridine-2-carboxamide (PubChem CID 118851932) has the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. Its IUPAC name is 4-(difluoromethyl)-5-fluoro-6-methylpyridine-2-carboxamide.
| Compound Name | 4-(difluoromethyl)-5-fluoro-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 118851932 |
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 4-(difluoromethyl)-5-fluoro-6-methylpyridine-2-carboxamide |
| SMILES | Cc1nc(C(N)=O)cc(C(F)F)c1F |
| InChI | InChI=1S/C8H7F3N2O/c1-3-6(9)4(7(10)11)2-5(13-3)8(12)14/h2,7H,1H3,(H2,12,14) |
| InChIKey | ZAXAQLGPCQJHNN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |