C9H6F5NO2 — CID 118846473
4-(difluoromethyl)-6-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 118846473) has the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | 4-(difluoromethyl)-6-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118846473 |
| Molecular Formula | C9H6F5NO2 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-(difluoromethyl)-6-methyl-5-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | Cc1nc(C(=O)O)cc(C(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H6F5NO2/c1-3-6(9(12,13)14)4(7(10)11)2-5(15-3)8(16)17/h2,7H,1H3,(H,16,17) |
| InChIKey | YOHJIOGXSNZATM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |