C8H7F2NO2 — CID 118846293
4-(difluoromethyl)-6-methylpyridine-2-carboxylic acid (PubChem CID 118846293) has the molecular formula C8H7F2NO2 and a molecular weight of 187.15 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-methylpyridine-2-carboxylic acid.
| Compound Name | 4-(difluoromethyl)-6-methylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118846293 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 4-(difluoromethyl)-6-methylpyridine-2-carboxylic acid |
| SMILES | Cc1cc(C(F)F)cc(C(=O)O)n1 |
| InChI | InChI=1S/C8H7F2NO2/c1-4-2-5(7(9)10)3-6(11-4)8(12)13/h2-3,7H,1H3,(H,12,13) |
| InChIKey | HSOSLOZORRYFFB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |