6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride

C8H2BrClF2N2O — CID 134675207

IUPAC6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride
SMILESN#Cc1nc(Br)cc(C(F)F)c1C(=O)Cl
InChIInChI=1S/C8H2BrClF2N2O/c9-5-1-3(8(11)12)6(7(10)15)4(2-13)14-5/h1,8H
InChIKeyBTESDDPIAMRZCX-UHFFFAOYSA-N
MW295.47 g/mol
LogP3.03
Rot. Bonds2

About 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride

6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride (PubChem CID 134675207) has the molecular formula C8H2BrClF2N2O and a molecular weight of 295.47 g/mol. Its IUPAC name is 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride.

Molecular Properties

Compound Name6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride
PubChem CID134675207
Molecular FormulaC8H2BrClF2N2O
Molecular Weight295.47 g/mol
Exact Mass293.90
IUPAC Name6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride
SMILESN#Cc1nc(Br)cc(C(F)F)c1C(=O)Cl
InChIInChI=1S/C8H2BrClF2N2O/c9-5-1-3(8(11)12)6(7(10)15)4(2-13)14-5/h1,8H
InChIKeyBTESDDPIAMRZCX-UHFFFAOYSA-N
XLogP3.03
TPSA53.75 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.47
LogP ≤ 53.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride?
The IUPAC name of 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride (CID 134675207) is 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride.
What is the SMILES notation for 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride?
The canonical SMILES for 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride is N#Cc1nc(Br)cc(C(F)F)c1C(=O)Cl.
What is the InChIKey of 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride?
The InChIKey is BTESDDPIAMRZCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2BrClF2N2O/c9-5-1-3(8(11)12)6(7(10)15)4(2-13)14-5/h1,8H.
What are the key properties of 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride?
6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride has a molecular weight of 295.47 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-cyano-4-(difluoromethyl)pyridine-3-carbonyl chloride is sourced from PubChem (CID 134675207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).