C9H5F6NO3 — CID 134677546
methyl 5-(difluoromethyl)-4-fluoro-2-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 134677546) has the molecular formula C9H5F6NO3 and a molecular weight of 289.13 g/mol. Its IUPAC name is methyl 5-(difluoromethyl)-4-fluoro-2-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | methyl 5-(difluoromethyl)-4-fluoro-2-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134677546 |
| Molecular Formula | C9H5F6NO3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | methyl 5-(difluoromethyl)-4-fluoro-2-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(OC(F)(F)F)ncc(C(F)F)c1F |
| InChI | InChI=1S/C9H5F6NO3/c1-18-8(17)4-5(10)3(6(11)12)2-16-7(4)19-9(13,14)15/h2,6H,1H3 |
| InChIKey | MADMPUJSTFKUAD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |