C9H5F5INO3 — CID 134661548
methyl 5-(difluoromethyl)-2-iodo-4-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 134661548) has the molecular formula C9H5F5INO3 and a molecular weight of 397.04 g/mol. Its IUPAC name is methyl 5-(difluoromethyl)-2-iodo-4-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | methyl 5-(difluoromethyl)-2-iodo-4-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134661548 |
| Molecular Formula | C9H5F5INO3 |
| Molecular Weight | 397.04 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | methyl 5-(difluoromethyl)-2-iodo-4-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(I)ncc(C(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C9H5F5INO3/c1-18-8(17)4-5(19-9(12,13)14)3(6(10)11)2-16-7(4)15/h2,6H,1H3 |
| InChIKey | UAUIODOUBYTQHD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|