C9H6F5NO4 — CID 134660809
methyl 2-(difluoromethyl)-5-hydroxy-3-(trifluoromethoxy)pyridine-4-carboxylate (PubChem CID 134660809) has the molecular formula C9H6F5NO4 and a molecular weight of 287.14 g/mol. Its IUPAC name is methyl 2-(difluoromethyl)-5-hydroxy-3-(trifluoromethoxy)pyridine-4-carboxylate.
| Compound Name | methyl 2-(difluoromethyl)-5-hydroxy-3-(trifluoromethoxy)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 134660809 |
| Molecular Formula | C9H6F5NO4 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | methyl 2-(difluoromethyl)-5-hydroxy-3-(trifluoromethoxy)pyridine-4-carboxylate |
| SMILES | COC(=O)c1c(O)cnc(C(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C9H6F5NO4/c1-18-8(17)4-3(16)2-15-5(7(10)11)6(4)19-9(12,13)14/h2,7,16H,1H3 |
| InChIKey | DIEYGEZEIUTCOS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |