C8H4F5NO4 — CID 118842969
2-(difluoromethyl)-5-hydroxy-4-(trifluoromethoxy)pyridine-3-carboxylic acid (PubChem CID 118842969) has the molecular formula C8H4F5NO4 and a molecular weight of 273.11 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-hydroxy-4-(trifluoromethoxy)pyridine-3-carboxylic acid.
| Compound Name | 2-(difluoromethyl)-5-hydroxy-4-(trifluoromethoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118842969 |
| Molecular Formula | C8H4F5NO4 |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 2-(difluoromethyl)-5-hydroxy-4-(trifluoromethoxy)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(C(F)F)ncc(O)c1OC(F)(F)F |
| InChI | InChI=1S/C8H4F5NO4/c9-6(10)4-3(7(16)17)5(2(15)1-14-4)18-8(11,12)13/h1,6,15H,(H,16,17) |
| InChIKey | JWZPUNSZVIOJTJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |