C9H5BrF5NO3 — CID 118827001
2-(bromomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)pyridine-4-carboxylic acid (PubChem CID 118827001) has the molecular formula C9H5BrF5NO3 and a molecular weight of 350.04 g/mol. Its IUPAC name is 2-(bromomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)pyridine-4-carboxylic acid.
| Compound Name | 2-(bromomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 118827001 |
| Molecular Formula | C9H5BrF5NO3 |
| Molecular Weight | 350.04 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | 2-(bromomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1c(C(F)F)cnc(CBr)c1OC(F)(F)F |
| InChI | InChI=1S/C9H5BrF5NO3/c10-1-4-6(19-9(13,14)15)5(8(17)18)3(2-16-4)7(11)12/h2,7H,1H2,(H,17,18) |
| InChIKey | DPMHQYCOAVIHAN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.04 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|