C9H4BrF8NO — CID 134667801
2-(bromomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine (PubChem CID 134667801) has the molecular formula C9H4BrF8NO and a molecular weight of 374.03 g/mol. Its IUPAC name is 2-(bromomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine.
| Compound Name | 2-(bromomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134667801 |
| Molecular Formula | C9H4BrF8NO |
| Molecular Weight | 374.03 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 2-(bromomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine |
| SMILES | FC(F)c1cnc(CBr)c(OC(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H4BrF8NO/c10-1-4-6(20-9(16,17)18)5(8(13,14)15)3(2-19-4)7(11)12/h2,7H,1H2 |
| InChIKey | NGKSOMQPTWBCSZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.03 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|