C9H6F8N2O — CID 134672562
[5-(difluoromethyl)-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]methanamine (PubChem CID 134672562) has the molecular formula C9H6F8N2O and a molecular weight of 310.14 g/mol. Its IUPAC name is [5-(difluoromethyl)-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]methanamine.
| Compound Name | [5-(difluoromethyl)-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 134672562 |
| Molecular Formula | C9H6F8N2O |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | [5-(difluoromethyl)-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]methanamine |
| SMILES | NCc1ncc(C(F)F)c(OC(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H6F8N2O/c10-7(11)3-2-19-4(1-18)5(8(12,13)14)6(3)20-9(15,16)17/h2,7H,1,18H2 |
| InChIKey | JNRKLSVVWQETGE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |