C9H5ClF6N2O2 — CID 134682245
6-(aminomethyl)-4-(trifluoromethoxy)-5-(trifluoromethyl)pyridine-3-carbonyl chloride (PubChem CID 134682245) has the molecular formula C9H5ClF6N2O2 and a molecular weight of 322.59 g/mol. Its IUPAC name is 6-(aminomethyl)-4-(trifluoromethoxy)-5-(trifluoromethyl)pyridine-3-carbonyl chloride.
| Compound Name | 6-(aminomethyl)-4-(trifluoromethoxy)-5-(trifluoromethyl)pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 134682245 |
| Molecular Formula | C9H5ClF6N2O2 |
| Molecular Weight | 322.59 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 6-(aminomethyl)-4-(trifluoromethoxy)-5-(trifluoromethyl)pyridine-3-carbonyl chloride |
| SMILES | NCc1ncc(C(=O)Cl)c(OC(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H5ClF6N2O2/c10-7(19)3-2-18-4(1-17)5(8(11,12)13)6(3)20-9(14,15)16/h2H,1,17H2 |
| InChIKey | VZXKVGJXXBRVMK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|