C9H6ClF5N2O2 — CID 134678964
4-(aminomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carbonyl chloride (PubChem CID 134678964) has the molecular formula C9H6ClF5N2O2 and a molecular weight of 304.60 g/mol. Its IUPAC name is 4-(aminomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carbonyl chloride.
| Compound Name | 4-(aminomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 134678964 |
| Molecular Formula | C9H6ClF5N2O2 |
| Molecular Weight | 304.60 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 4-(aminomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carbonyl chloride |
| SMILES | NCc1c(C(=O)Cl)cnc(C(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C9H6ClF5N2O2/c10-7(18)4-2-17-5(8(11)12)6(3(4)1-16)19-9(13,14)15/h2,8H,1,16H2 |
| InChIKey | URBNVLAJKHJFKR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.60 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|