C8H5F5INO2 — CID 118815229
[2-(difluoromethyl)-5-iodo-3-(trifluoromethoxy)-4-pyridinyl]methanol (PubChem CID 118815229) has the molecular formula C8H5F5INO2 and a molecular weight of 369.03 g/mol. Its IUPAC name is [2-(difluoromethyl)-5-iodo-3-(trifluoromethoxy)-4-pyridinyl]methanol.
| Compound Name | [2-(difluoromethyl)-5-iodo-3-(trifluoromethoxy)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 118815229 |
| Molecular Formula | C8H5F5INO2 |
| Molecular Weight | 369.03 g/mol |
| Exact Mass | 368.93 |
| IUPAC Name | [2-(difluoromethyl)-5-iodo-3-(trifluoromethoxy)-4-pyridinyl]methanol |
| SMILES | OCc1c(I)cnc(C(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C8H5F5INO2/c9-7(10)5-6(17-8(11,12)13)3(2-16)4(14)1-15-5/h1,7,16H,2H2 |
| InChIKey | YDCFQAXJLGCRHC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.03 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|