C8H6BrF3INO2 — CID 118843706
[2-(bromomethyl)-5-iodo-3-(trifluoromethoxy)-4-pyridinyl]methanol (PubChem CID 118843706) has the molecular formula C8H6BrF3INO2 and a molecular weight of 411.94 g/mol. Its IUPAC name is [2-(bromomethyl)-5-iodo-3-(trifluoromethoxy)-4-pyridinyl]methanol.
| Compound Name | [2-(bromomethyl)-5-iodo-3-(trifluoromethoxy)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 118843706 |
| Molecular Formula | C8H6BrF3INO2 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 410.86 |
| IUPAC Name | [2-(bromomethyl)-5-iodo-3-(trifluoromethoxy)-4-pyridinyl]methanol |
| SMILES | OCc1c(I)cnc(CBr)c1OC(F)(F)F |
| InChI | InChI=1S/C8H6BrF3INO2/c9-1-6-7(16-8(10,11)12)4(3-15)5(13)2-14-6/h2,15H,1,3H2 |
| InChIKey | ISNLNZDLPXMNHF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|