C9H6BrF6NO2 — CID 134672615
[2-(bromomethyl)-5-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]methanol (PubChem CID 134672615) has the molecular formula C9H6BrF6NO2 and a molecular weight of 354.04 g/mol. Its IUPAC name is [2-(bromomethyl)-5-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]methanol.
| Compound Name | [2-(bromomethyl)-5-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 134672615 |
| Molecular Formula | C9H6BrF6NO2 |
| Molecular Weight | 354.04 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | [2-(bromomethyl)-5-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]methanol |
| SMILES | OCc1c(OC(F)(F)F)cnc(CBr)c1C(F)(F)F |
| InChI | InChI=1S/C9H6BrF6NO2/c10-1-5-7(8(11,12)13)4(3-18)6(2-17-5)19-9(14,15)16/h2,18H,1,3H2 |
| InChIKey | KGAYNIDPMOKKDD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.04 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|