C9H9F5N2O2 — CID 134672695
[4-(aminomethyl)-3-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]methanol (PubChem CID 134672695) has the molecular formula C9H9F5N2O2 and a molecular weight of 272.17 g/mol. Its IUPAC name is [4-(aminomethyl)-3-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]methanol.
| Compound Name | [4-(aminomethyl)-3-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 134672695 |
| Molecular Formula | C9H9F5N2O2 |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | [4-(aminomethyl)-3-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]methanol |
| SMILES | NCc1c(OC(F)(F)F)cnc(CO)c1C(F)F |
| InChI | InChI=1S/C9H9F5N2O2/c10-8(11)7-4(1-15)6(18-9(12,13)14)2-16-5(7)3-17/h2,8,17H,1,3,15H2 |
| InChIKey | BMEQVUAFYVVYFQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |