C8H9F3N2O3 — CID 118825651
2-(aminomethyl)-4-(hydroxymethyl)-5-(trifluoromethoxy)pyridin-3-ol (PubChem CID 118825651) has the molecular formula C8H9F3N2O3 and a molecular weight of 238.16 g/mol. Its IUPAC name is 2-(aminomethyl)-4-(hydroxymethyl)-5-(trifluoromethoxy)pyridin-3-ol.
| Compound Name | 2-(aminomethyl)-4-(hydroxymethyl)-5-(trifluoromethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 118825651 |
| Molecular Formula | C8H9F3N2O3 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(aminomethyl)-4-(hydroxymethyl)-5-(trifluoromethoxy)pyridin-3-ol |
| SMILES | NCc1ncc(OC(F)(F)F)c(CO)c1O |
| InChI | InChI=1S/C8H9F3N2O3/c9-8(10,11)16-6-2-13-5(1-12)7(15)4(6)3-14/h2,14-15H,1,3,12H2 |
| InChIKey | RUNVXAZWFGHIJE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |