C8H7F3INO2 — CID 130112949
[5-iodo-4-methyl-3-(trifluoromethoxy)-2-pyridinyl]methanol (PubChem CID 130112949) has the molecular formula C8H7F3INO2 and a molecular weight of 333.05 g/mol. Its IUPAC name is [5-iodo-4-methyl-3-(trifluoromethoxy)-2-pyridinyl]methanol.
| Compound Name | [5-iodo-4-methyl-3-(trifluoromethoxy)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 130112949 |
| Molecular Formula | C8H7F3INO2 |
| Molecular Weight | 333.05 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | [5-iodo-4-methyl-3-(trifluoromethoxy)-2-pyridinyl]methanol |
| SMILES | Cc1c(I)cnc(CO)c1OC(F)(F)F |
| InChI | InChI=1S/C8H7F3INO2/c1-4-5(12)2-13-6(3-14)7(4)15-8(9,10)11/h2,14H,3H2,1H3 |
| InChIKey | RRSLXCFIARZBBS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.05 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|