C8H6F5NO2 — CID 134680899
[5-fluoro-2-(fluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]methanol (PubChem CID 134680899) has the molecular formula C8H6F5NO2 and a molecular weight of 243.13 g/mol. Its IUPAC name is [5-fluoro-2-(fluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]methanol.
| Compound Name | [5-fluoro-2-(fluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 134680899 |
| Molecular Formula | C8H6F5NO2 |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | [5-fluoro-2-(fluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]methanol |
| SMILES | OCc1c(CF)ncc(F)c1OC(F)(F)F |
| InChI | InChI=1S/C8H6F5NO2/c9-1-6-4(3-15)7(5(10)2-14-6)16-8(11,12)13/h2,15H,1,3H2 |
| InChIKey | IOLUDIUYCWMITM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |