C8H3F8NO — CID 134680128
5-fluoro-2-(fluoromethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine (PubChem CID 134680128) has the molecular formula C8H3F8NO and a molecular weight of 281.10 g/mol. Its IUPAC name is 5-fluoro-2-(fluoromethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine.
| Compound Name | 5-fluoro-2-(fluoromethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134680128 |
| Molecular Formula | C8H3F8NO |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 5-fluoro-2-(fluoromethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine |
| SMILES | FCc1ncc(F)c(C(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C8H3F8NO/c9-1-4-6(18-8(14,15)16)5(7(11,12)13)3(10)2-17-4/h2H,1H2 |
| InChIKey | WTINYVAZWGHZPY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |