C9H5F6NO4 — CID 134659981
2-[5-hydroxy-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]acetic acid (PubChem CID 134659981) has the molecular formula C9H5F6NO4 and a molecular weight of 305.13 g/mol. Its IUPAC name is 2-[5-hydroxy-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-hydroxy-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134659981 |
| Molecular Formula | C9H5F6NO4 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-[5-hydroxy-3-(trifluoromethoxy)-4-(trifluoromethyl)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ncc(O)c(C(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C9H5F6NO4/c10-8(11,12)6-4(17)2-16-3(1-5(18)19)7(6)20-9(13,14)15/h2,17H,1H2,(H,18,19) |
| InChIKey | BOPXFYKTUADKRU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |