C9H6F3N3O3 — CID 118812212
2-[4-amino-5-cyano-3-(trifluoromethoxy)-2-pyridinyl]acetic acid (PubChem CID 118812212) has the molecular formula C9H6F3N3O3 and a molecular weight of 261.16 g/mol. Its IUPAC name is 2-[4-amino-5-cyano-3-(trifluoromethoxy)-2-pyridinyl]acetic acid.
| Compound Name | 2-[4-amino-5-cyano-3-(trifluoromethoxy)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118812212 |
| Molecular Formula | C9H6F3N3O3 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-[4-amino-5-cyano-3-(trifluoromethoxy)-2-pyridinyl]acetic acid |
| SMILES | N#Cc1cnc(CC(=O)O)c(OC(F)(F)F)c1N |
| InChI | InChI=1S/C9H6F3N3O3/c10-9(11,12)18-8-5(1-6(16)17)15-3-4(2-13)7(8)14/h3H,1H2,(H2,14,15)(H,16,17) |
| InChIKey | UQZCJMJYQWTACG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |