C8H6F4N2O3 — CID 118812154
2-[4-amino-3-fluoro-5-(trifluoromethoxy)-2-pyridinyl]acetic acid (PubChem CID 118812154) has the molecular formula C8H6F4N2O3 and a molecular weight of 254.14 g/mol. Its IUPAC name is 2-[4-amino-3-fluoro-5-(trifluoromethoxy)-2-pyridinyl]acetic acid.
| Compound Name | 2-[4-amino-3-fluoro-5-(trifluoromethoxy)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118812154 |
| Molecular Formula | C8H6F4N2O3 |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-[4-amino-3-fluoro-5-(trifluoromethoxy)-2-pyridinyl]acetic acid |
| SMILES | Nc1c(OC(F)(F)F)cnc(CC(=O)O)c1F |
| InChI | InChI=1S/C8H6F4N2O3/c9-6-3(1-5(15)16)14-2-4(7(6)13)17-8(10,11)12/h2H,1H2,(H2,13,14)(H,15,16) |
| InChIKey | YZYHSZAZUKWSNO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |