C9H7BrF3NO4 — CID 134660623
2-[4-(bromomethyl)-5-hydroxy-3-(trifluoromethoxy)-2-pyridinyl]acetic acid (PubChem CID 134660623) has the molecular formula C9H7BrF3NO4 and a molecular weight of 330.06 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-5-hydroxy-3-(trifluoromethoxy)-2-pyridinyl]acetic acid.
| Compound Name | 2-[4-(bromomethyl)-5-hydroxy-3-(trifluoromethoxy)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134660623 |
| Molecular Formula | C9H7BrF3NO4 |
| Molecular Weight | 330.06 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 2-[4-(bromomethyl)-5-hydroxy-3-(trifluoromethoxy)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ncc(O)c(CBr)c1OC(F)(F)F |
| InChI | InChI=1S/C9H7BrF3NO4/c10-2-4-6(15)3-14-5(1-7(16)17)8(4)18-9(11,12)13/h3,15H,1-2H2,(H,16,17) |
| InChIKey | BPXPQXHMVXIQRC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.06 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|