C9H8F3NO4 — CID 134680979
2-[5-hydroxy-2-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid (PubChem CID 134680979) has the molecular formula C9H8F3NO4 and a molecular weight of 251.16 g/mol. Its IUPAC name is 2-[5-hydroxy-2-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid.
| Compound Name | 2-[5-hydroxy-2-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134680979 |
| Molecular Formula | C9H8F3NO4 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-[5-hydroxy-2-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid |
| SMILES | Cc1ncc(O)c(OC(F)(F)F)c1CC(=O)O |
| InChI | InChI=1S/C9H8F3NO4/c1-4-5(2-7(15)16)8(6(14)3-13-4)17-9(10,11)12/h3,14H,2H2,1H3,(H,15,16) |
| InChIKey | KPVKCVMETHNZJC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |