C9H7F3INO4 — CID 134659697
methyl 2-[5-hydroxy-2-iodo-4-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134659697) has the molecular formula C9H7F3INO4 and a molecular weight of 377.06 g/mol. Its IUPAC name is methyl 2-[5-hydroxy-2-iodo-4-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[5-hydroxy-2-iodo-4-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134659697 |
| Molecular Formula | C9H7F3INO4 |
| Molecular Weight | 377.06 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | methyl 2-[5-hydroxy-2-iodo-4-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1c(I)ncc(O)c1OC(F)(F)F |
| InChI | InChI=1S/C9H7F3INO4/c1-17-6(16)2-4-7(18-9(10,11)12)5(15)3-14-8(4)13/h3,15H,2H2,1H3 |
| InChIKey | FNBHJMRZXUAMLU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.06 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|