C10H9F3INO3 — CID 134679712
methyl 2-[3-iodo-5-methyl-4-(trifluoromethoxy)-2-pyridinyl]acetate (PubChem CID 134679712) has the molecular formula C10H9F3INO3 and a molecular weight of 375.08 g/mol. Its IUPAC name is methyl 2-[3-iodo-5-methyl-4-(trifluoromethoxy)-2-pyridinyl]acetate.
| Compound Name | methyl 2-[3-iodo-5-methyl-4-(trifluoromethoxy)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134679712 |
| Molecular Formula | C10H9F3INO3 |
| Molecular Weight | 375.08 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | methyl 2-[3-iodo-5-methyl-4-(trifluoromethoxy)-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1ncc(C)c(OC(F)(F)F)c1I |
| InChI | InChI=1S/C10H9F3INO3/c1-5-4-15-6(3-7(16)17-2)8(14)9(5)18-10(11,12)13/h4H,3H2,1-2H3 |
| InChIKey | VJWVQHUNMFWNSS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.08 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|