C10H8F4INO3 — CID 134681457
methyl 2-[2-(fluoromethyl)-4-iodo-5-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134681457) has the molecular formula C10H8F4INO3 and a molecular weight of 393.07 g/mol. Its IUPAC name is methyl 2-[2-(fluoromethyl)-4-iodo-5-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[2-(fluoromethyl)-4-iodo-5-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134681457 |
| Molecular Formula | C10H8F4INO3 |
| Molecular Weight | 393.07 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | methyl 2-[2-(fluoromethyl)-4-iodo-5-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1c(CF)ncc(OC(F)(F)F)c1I |
| InChI | InChI=1S/C10H8F4INO3/c1-18-8(17)2-5-6(3-11)16-4-7(9(5)15)19-10(12,13)14/h4H,2-3H2,1H3 |
| InChIKey | GAYRQSVIUKHWSS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.07 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|