C11H13F3N2O4 — CID 134668868
methyl 2-[4-(aminomethyl)-2-methoxy-5-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134668868) has the molecular formula C11H13F3N2O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is methyl 2-[4-(aminomethyl)-2-methoxy-5-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[4-(aminomethyl)-2-methoxy-5-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134668868 |
| Molecular Formula | C11H13F3N2O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | methyl 2-[4-(aminomethyl)-2-methoxy-5-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1c(OC)ncc(OC(F)(F)F)c1CN |
| InChI | InChI=1S/C11H13F3N2O4/c1-18-9(17)3-6-7(4-15)8(20-11(12,13)14)5-16-10(6)19-2/h5H,3-4,15H2,1-2H3 |
| InChIKey | IXGYRHHEYYXNCN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |