C10H12F3N3O3 — CID 133086083
methyl 2-[6-amino-2-(aminomethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 133086083) has the molecular formula C10H12F3N3O3 and a molecular weight of 279.22 g/mol. Its IUPAC name is methyl 2-[6-amino-2-(aminomethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[6-amino-2-(aminomethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133086083 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | methyl 2-[6-amino-2-(aminomethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1c(OC(F)(F)F)cc(N)nc1CN |
| InChI | InChI=1S/C10H12F3N3O3/c1-18-9(17)2-5-6(4-14)16-8(15)3-7(5)19-10(11,12)13/h3H,2,4,14H2,1H3,(H2,15,16) |
| InChIKey | KGKJPNZOKZWILY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |