C11H11F5N2O3 — CID 134682211
methyl 2-[4-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134682211) has the molecular formula C11H11F5N2O3 and a molecular weight of 314.21 g/mol. Its IUPAC name is methyl 2-[4-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[4-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134682211 |
| Molecular Formula | C11H11F5N2O3 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | methyl 2-[4-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cnc(OC(F)(F)F)c(C(F)F)c1CN |
| InChI | InChI=1S/C11H11F5N2O3/c1-20-7(19)2-5-4-18-10(21-11(14,15)16)8(9(12)13)6(5)3-17/h4,9H,2-3,17H2,1H3 |
| InChIKey | GCEYXVWTOTZSFB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |