C10H11F3N2O4 — CID 134665521
ethyl 3-(aminomethyl)-5-hydroxy-4-(trifluoromethoxy)pyridine-2-carboxylate (PubChem CID 134665521) has the molecular formula C10H11F3N2O4 and a molecular weight of 280.20 g/mol. Its IUPAC name is ethyl 3-(aminomethyl)-5-hydroxy-4-(trifluoromethoxy)pyridine-2-carboxylate.
| Compound Name | ethyl 3-(aminomethyl)-5-hydroxy-4-(trifluoromethoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134665521 |
| Molecular Formula | C10H11F3N2O4 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | ethyl 3-(aminomethyl)-5-hydroxy-4-(trifluoromethoxy)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(O)c(OC(F)(F)F)c1CN |
| InChI | InChI=1S/C10H11F3N2O4/c1-2-18-9(17)7-5(3-14)8(6(16)4-15-7)19-10(11,12)13/h4,16H,2-3,14H2,1H3 |
| InChIKey | BKODGOWLCBTXOT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |