C9H10F3N3O3 — CID 133085948
methyl 5-amino-3-(aminomethyl)-4-(trifluoromethoxy)pyridine-2-carboxylate (PubChem CID 133085948) has the molecular formula C9H10F3N3O3 and a molecular weight of 265.19 g/mol. Its IUPAC name is methyl 5-amino-3-(aminomethyl)-4-(trifluoromethoxy)pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-3-(aminomethyl)-4-(trifluoromethoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 133085948 |
| Molecular Formula | C9H10F3N3O3 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | methyl 5-amino-3-(aminomethyl)-4-(trifluoromethoxy)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(N)c(OC(F)(F)F)c1CN |
| InChI | InChI=1S/C9H10F3N3O3/c1-17-8(16)6-4(2-13)7(5(14)3-15-6)18-9(10,11)12/h3H,2,13-14H2,1H3 |
| InChIKey | QEXYUCNFADTEDE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |