C10H11F3N2O3 — CID 133085417
methyl 5-(aminomethyl)-4-methyl-3-(trifluoromethoxy)pyridine-2-carboxylate (PubChem CID 133085417) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is methyl 5-(aminomethyl)-4-methyl-3-(trifluoromethoxy)pyridine-2-carboxylate.
| Compound Name | methyl 5-(aminomethyl)-4-methyl-3-(trifluoromethoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 133085417 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | methyl 5-(aminomethyl)-4-methyl-3-(trifluoromethoxy)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(CN)c(C)c1OC(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O3/c1-5-6(3-14)4-15-7(9(16)17-2)8(5)18-10(11,12)13/h4H,3,14H2,1-2H3 |
| InChIKey | SEGGLVOMVBZWHK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |