C9H8F3NO4 — CID 134679830
methyl 3-hydroxy-4-methyl-5-(trifluoromethoxy)pyridine-2-carboxylate (PubChem CID 134679830) has the molecular formula C9H8F3NO4 and a molecular weight of 251.16 g/mol. Its IUPAC name is methyl 3-hydroxy-4-methyl-5-(trifluoromethoxy)pyridine-2-carboxylate.
| Compound Name | methyl 3-hydroxy-4-methyl-5-(trifluoromethoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134679830 |
| Molecular Formula | C9H8F3NO4 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | methyl 3-hydroxy-4-methyl-5-(trifluoromethoxy)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(OC(F)(F)F)c(C)c1O |
| InChI | InChI=1S/C9H8F3NO4/c1-4-5(17-9(10,11)12)3-13-6(7(4)14)8(15)16-2/h3,14H,1-2H3 |
| InChIKey | GRGQUVNSXIYMSX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |