C9H4F7NO3 — CID 134663820
methyl 3-fluoro-5-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 134663820) has the molecular formula C9H4F7NO3 and a molecular weight of 307.12 g/mol. Its IUPAC name is methyl 3-fluoro-5-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-fluoro-5-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134663820 |
| Molecular Formula | C9H4F7NO3 |
| Molecular Weight | 307.12 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | methyl 3-fluoro-5-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(OC(F)(F)F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C9H4F7NO3/c1-19-7(18)6-5(10)4(8(11,12)13)3(2-17-6)20-9(14,15)16/h2H,1H3 |
| InChIKey | PVVWTSMLFGBHGT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |