C7H4BrF2NO2 — CID 141301095
methyl 4-bromo-3,5-difluoropyridine-2-carboxylate (PubChem CID 141301095) has the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. Its IUPAC name is methyl 4-bromo-3,5-difluoropyridine-2-carboxylate.
| Compound Name | methyl 4-bromo-3,5-difluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 141301095 |
| Molecular Formula | C7H4BrF2NO2 |
| Molecular Weight | 252.01 g/mol |
| Exact Mass | 250.94 |
| IUPAC Name | methyl 4-bromo-3,5-difluoropyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(F)c(Br)c1F |
| InChI | InChI=1S/C7H4BrF2NO2/c1-13-7(12)6-5(10)4(8)3(9)2-11-6/h2H,1H3 |
| InChIKey | KCOPCXNDFOZSBE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.01 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |