C10H10F3NO5 — CID 134666742
ethyl 3-hydroxy-5-methoxy-4-(trifluoromethoxy)pyridine-2-carboxylate (PubChem CID 134666742) has the molecular formula C10H10F3NO5 and a molecular weight of 281.19 g/mol. Its IUPAC name is ethyl 3-hydroxy-5-methoxy-4-(trifluoromethoxy)pyridine-2-carboxylate.
| Compound Name | ethyl 3-hydroxy-5-methoxy-4-(trifluoromethoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134666742 |
| Molecular Formula | C10H10F3NO5 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | ethyl 3-hydroxy-5-methoxy-4-(trifluoromethoxy)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(OC)c(OC(F)(F)F)c1O |
| InChI | InChI=1S/C10H10F3NO5/c1-3-18-9(16)6-7(15)8(19-10(11,12)13)5(17-2)4-14-6/h4,15H,3H2,1-2H3 |
| InChIKey | LMGYUXQQQUWETQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |