C8H6F3N3O2 — CID 131600848
5-amino-6-(hydroxymethyl)-4-(trifluoromethoxy)pyridine-3-carbonitrile (PubChem CID 131600848) has the molecular formula C8H6F3N3O2 and a molecular weight of 233.15 g/mol. Its IUPAC name is 5-amino-6-(hydroxymethyl)-4-(trifluoromethoxy)pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-(hydroxymethyl)-4-(trifluoromethoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 131600848 |
| Molecular Formula | C8H6F3N3O2 |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 5-amino-6-(hydroxymethyl)-4-(trifluoromethoxy)pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(CO)c(N)c1OC(F)(F)F |
| InChI | InChI=1S/C8H6F3N3O2/c9-8(10,11)16-7-4(1-12)2-14-5(3-15)6(7)13/h2,15H,3,13H2 |
| InChIKey | NAXCSNKLHQJYKZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |